C13H18O3S — CID 158263200
5-(2-methoxyethylsulfonyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 158263200) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is 5-(2-methoxyethylsulfonyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-(2-methoxyethylsulfonyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 158263200 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 5-(2-methoxyethylsulfonyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | COCCS(=O)(=O)c1cccc2c1CCCC2 |
| InChI | InChI=1S/C13H18O3S/c1-16-9-10-17(14,15)13-8-4-6-11-5-2-3-7-12(11)13/h4,6,8H,2-3,5,7,9-10H2,1H3 |
| InChIKey | IYSGSJUMJISLMU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |