C9H12ClNO2S — CID 143451550
2,3-dihydro-1H-indene-4-sulfonamide;hydrochloride (PubChem CID 143451550) has the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene-4-sulfonamide;hydrochloride.
| Compound Name | 2,3-dihydro-1H-indene-4-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 143451550 |
| Molecular Formula | C9H12ClNO2S |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 2,3-dihydro-1H-indene-4-sulfonamide;hydrochloride |
| SMILES | Cl.NS(=O)(=O)c1cccc2c1CCC2 |
| InChI | InChI=1S/C9H11NO2S.ClH/c10-13(11,12)9-6-2-4-7-3-1-5-8(7)9;/h2,4,6H,1,3,5H2,(H2,10,11,12);1H |
| InChIKey | OZYHVNJWTIYPOE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |