C12H16N2O4S — CID 171134172
3-cyano-4-ethoxy-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 171134172) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-cyano-4-ethoxy-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 3-cyano-4-ethoxy-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 171134172 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-cyano-4-ethoxy-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCCOC)cc1C#N |
| InChI | InChI=1S/C12H16N2O4S/c1-3-18-12-5-4-11(8-10(12)9-13)19(15,16)14-6-7-17-2/h4-5,8,14H,3,6-7H2,1-2H3 |
| InChIKey | AOHZWCQIQILZJQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|