C15H25NO5S — CID 9173625
3,4-diethoxy-N-(3-ethoxypropyl)benzenesulfonamide (PubChem CID 9173625) has the molecular formula C15H25NO5S and a molecular weight of 331.43 g/mol. Its IUPAC name is 3,4-diethoxy-N-(3-ethoxypropyl)benzenesulfonamide.
| Compound Name | 3,4-diethoxy-N-(3-ethoxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 9173625 |
| Molecular Formula | C15H25NO5S |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 3,4-diethoxy-N-(3-ethoxypropyl)benzenesulfonamide |
| SMILES | CCOCCCNS(=O)(=O)c1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C15H25NO5S/c1-4-19-11-7-10-16-22(17,18)13-8-9-14(20-5-2)15(12-13)21-6-3/h8-9,12,16H,4-7,10-11H2,1-3H3 |
| InChIKey | ITVLXQIZFANTCL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|