C14H23NO5S — CID 64912288
3,4-diethoxy-N-(3-hydroxybutyl)benzenesulfonamide (PubChem CID 64912288) has the molecular formula C14H23NO5S and a molecular weight of 317.41 g/mol. Its IUPAC name is 3,4-diethoxy-N-(3-hydroxybutyl)benzenesulfonamide.
| Compound Name | 3,4-diethoxy-N-(3-hydroxybutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 64912288 |
| Molecular Formula | C14H23NO5S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 3,4-diethoxy-N-(3-hydroxybutyl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCCC(C)O)cc1OCC |
| InChI | InChI=1S/C14H23NO5S/c1-4-19-13-7-6-12(10-14(13)20-5-2)21(17,18)15-9-8-11(3)16/h6-7,10-11,15-16H,4-5,8-9H2,1-3H3 |
| InChIKey | DVFJLPQCUUNMAX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |