C18H30N2O5S — CID 55521871
N-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-3,4-diethoxybenzenesulfonamide (PubChem CID 55521871) has the molecular formula C18H30N2O5S and a molecular weight of 386.51 g/mol. Its IUPAC name is N-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-3,4-diethoxybenzenesulfonamide.
| Compound Name | N-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-3,4-diethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 55521871 |
| Molecular Formula | C18H30N2O5S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | N-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-3,4-diethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCCN2CC(C)OC(C)C2)cc1OCC |
| InChI | InChI=1S/C18H30N2O5S/c1-5-23-17-8-7-16(11-18(17)24-6-2)26(21,22)19-9-10-20-12-14(3)25-15(4)13-20/h7-8,11,14-15,19H,5-6,9-10,12-13H2,1-4H3 |
| InChIKey | LHLNIDSTEIRMLC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |