About 3-cyano-4-ethoxybenzenesulfonyl chloride;2-ethoxybenzonitrile
3-cyano-4-ethoxybenzenesulfonyl chloride;2-ethoxybenzonitrile (PubChem CID 158306651) has the molecular formula C18H17ClN2O4S
and a molecular weight of 392.86 g/mol. Its IUPAC name is 3-cyano-4-ethoxybenzenesulfonyl chloride;2-ethoxybenzonitrile.
Molecular Properties
| Compound Name | 3-cyano-4-ethoxybenzenesulfonyl chloride;2-ethoxybenzonitrile |
| PubChem CID | 158306651 |
| Molecular Formula | C18H17ClN2O4S |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 3-cyano-4-ethoxybenzenesulfonyl chloride;2-ethoxybenzonitrile |
| SMILES | CCOc1ccc(S(=O)(=O)Cl)cc1C#N.CCOc1ccccc1C#N |
| InChI | InChI=1S/C9H8ClNO3S.C9H9NO/c1-2-14-9-4-3-8(15(10,12)13)5-7(9)6-11;1-2-11-9-6-4-3-5-8(9)7-10/h3-5H,2H2,1H3;3-6H,2H2,1H3 |
| InChIKey | GNDVLYWLWNAPMM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-cyano-4-ethoxybenzenesulfonyl chloride;2-ethoxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-4-ethoxybenzenesulfonyl chloride;2-ethoxybenzonitrile?
The IUPAC name of 3-cyano-4-ethoxybenzenesulfonyl chloride;2-ethoxybenzonitrile (CID 158306651) is 3-cyano-4-ethoxybenzenesulfonyl chloride;2-ethoxybenzonitrile.
What is the SMILES notation for 3-cyano-4-ethoxybenzenesulfonyl chloride;2-ethoxybenzonitrile?
The canonical SMILES for 3-cyano-4-ethoxybenzenesulfonyl chloride;2-ethoxybenzonitrile is CCOc1ccc(S(=O)(=O)Cl)cc1C#N.CCOc1ccccc1C#N.
What is the InChIKey of 3-cyano-4-ethoxybenzenesulfonyl chloride;2-ethoxybenzonitrile?
The InChIKey is GNDVLYWLWNAPMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNO3S.C9H9NO/c1-2-14-9-4-3-8(15(10,12)13)5-7(9)6-11;1-2-11-9-6-4-3-5-8(9)7-10/h3-5H,2H2,1H3;3-6H,2H2,1H3.
What are the key properties of 3-cyano-4-ethoxybenzenesulfonyl chloride;2-ethoxybenzonitrile?
3-cyano-4-ethoxybenzenesulfonyl chloride;2-ethoxybenzonitrile has a molecular weight of 392.86 g/mol, XLogP of 3.84, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-4-ethoxybenzenesulfonyl chloride;2-ethoxybenzonitrile is sourced from PubChem (CID 158306651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).