C23H27NO3SSi — CID 134945061
(2R)-2-[1-(4-methylphenyl)sulfonylindol-3-yl]-5-trimethylsilylpent-4-yn-2-ol (PubChem CID 134945061) has the molecular formula C23H27NO3SSi and a molecular weight of 425.63 g/mol. Its IUPAC name is (2R)-2-[1-(4-methylphenyl)sulfonylindol-3-yl]-5-trimethylsilylpent-4-yn-2-ol.
| Compound Name | (2R)-2-[1-(4-methylphenyl)sulfonylindol-3-yl]-5-trimethylsilylpent-4-yn-2-ol |
|---|---|
| PubChem CID | 134945061 |
| Molecular Formula | C23H27NO3SSi |
| Molecular Weight | 425.63 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | (2R)-2-[1-(4-methylphenyl)sulfonylindol-3-yl]-5-trimethylsilylpent-4-yn-2-ol |
| SMILES | Cc1ccc(S(=O)(=O)n2cc([C@](C)(O)CC#C[Si](C)(C)C)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H27NO3SSi/c1-18-11-13-19(14-12-18)28(26,27)24-17-21(20-9-6-7-10-22(20)24)23(2,25)15-8-16-29(3,4)5/h6-7,9-14,17,25H,15H2,1-5H3/t23-/m1/s1 |
| InChIKey | PXUWQSQIIVZYOF-HSZRJFAPSA-N |
| XLogP | 4.67 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|