C24H18N2O3S — CID 101460041
5-[1-(benzenesulfonyl)indol-3-yl]-2-benzyl-1,3-oxazole (PubChem CID 101460041) has the molecular formula C24H18N2O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is 5-[1-(benzenesulfonyl)indol-3-yl]-2-benzyl-1,3-oxazole.
| Compound Name | 5-[1-(benzenesulfonyl)indol-3-yl]-2-benzyl-1,3-oxazole |
|---|---|
| PubChem CID | 101460041 |
| Molecular Formula | C24H18N2O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 5-[1-(benzenesulfonyl)indol-3-yl]-2-benzyl-1,3-oxazole |
| SMILES | O=S(=O)(c1ccccc1)n1cc(-c2cnc(Cc3ccccc3)o2)c2ccccc21 |
| InChI | InChI=1S/C24H18N2O3S/c27-30(28,19-11-5-2-6-12-19)26-17-21(20-13-7-8-14-22(20)26)23-16-25-24(29-23)15-18-9-3-1-4-10-18/h1-14,16-17H,15H2 |
| InChIKey | GLMCRLRWEJABQP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |