C14H17N3O4 — CID 147345487
methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-benzimidazole-2-carboxylate (PubChem CID 147345487) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-benzimidazole-2-carboxylate.
| Compound Name | methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-benzimidazole-2-carboxylate |
|---|---|
| PubChem CID | 147345487 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-benzimidazole-2-carboxylate |
| SMILES | COC(=O)c1nc2ccc(NC(=O)OC(C)(C)C)cc2[nH]1 |
| InChI | InChI=1S/C14H17N3O4/c1-14(2,3)21-13(19)15-8-5-6-9-10(7-8)17-11(16-9)12(18)20-4/h5-7H,1-4H3,(H,15,19)(H,16,17) |
| InChIKey | DEISGSBARUPVBX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |