C20H29N2O7P — CID 22645142
tert-butyl N-[2-[5-cyano-2-[(E)-2-diethoxyphosphoryloxyethenyl]phenoxy]ethyl]carbamate (PubChem CID 22645142) has the molecular formula C20H29N2O7P and a molecular weight of 440.43 g/mol. Its IUPAC name is tert-butyl N-[2-[5-cyano-2-[(E)-2-diethoxyphosphoryloxyethenyl]phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[5-cyano-2-[(E)-2-diethoxyphosphoryloxyethenyl]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 22645142 |
| Molecular Formula | C20H29N2O7P |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | tert-butyl N-[2-[5-cyano-2-[(E)-2-diethoxyphosphoryloxyethenyl]phenoxy]ethyl]carbamate |
| SMILES | CCOP(=O)(O/C=C/c1ccc(C#N)cc1OCCNC(=O)OC(C)(C)C)OCC |
| InChI | InChI=1S/C20H29N2O7P/c1-6-26-30(24,27-7-2)28-12-10-17-9-8-16(15-21)14-18(17)25-13-11-22-19(23)29-20(3,4)5/h8-10,12,14H,6-7,11,13H2,1-5H3,(H,22,23)/b12-10+ |
| InChIKey | LSGANFSAEGYWFY-ZRDIBKRKSA-N |
| XLogP | 4.63 |
| TPSA | 116.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|