C20H30N4O3 — CID 67103841
tert-butyl N-[5-(2-amino-5-cyano-N-propan-2-ylanilino)-5-oxopentyl]carbamate (PubChem CID 67103841) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is tert-butyl N-[5-(2-amino-5-cyano-N-propan-2-ylanilino)-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[5-(2-amino-5-cyano-N-propan-2-ylanilino)-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 67103841 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | tert-butyl N-[5-(2-amino-5-cyano-N-propan-2-ylanilino)-5-oxopentyl]carbamate |
| SMILES | CC(C)N(C(=O)CCCCNC(=O)OC(C)(C)C)c1cc(C#N)ccc1N |
| InChI | InChI=1S/C20H30N4O3/c1-14(2)24(17-12-15(13-21)9-10-16(17)22)18(25)8-6-7-11-23-19(26)27-20(3,4)5/h9-10,12,14H,6-8,11,22H2,1-5H3,(H,23,26) |
| InChIKey | NDOICJPWPLXJRX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|