C22H27FN3O2+ — CID 9300274
[2-(4-carbamoylanilino)-2-oxoethyl]-cyclohexyl-[(4-fluorophenyl)methyl]azanium (PubChem CID 9300274) has the molecular formula C22H27FN3O2+ and a molecular weight of 384.48 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl]-cyclohexyl-[(4-fluorophenyl)methyl]azanium.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl]-cyclohexyl-[(4-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 9300274 |
| Molecular Formula | C22H27FN3O2+ |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl]-cyclohexyl-[(4-fluorophenyl)methyl]azanium |
| SMILES | NC(=O)c1ccc(NC(=O)C[NH+](Cc2ccc(F)cc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H26FN3O2/c23-18-10-6-16(7-11-18)14-26(20-4-2-1-3-5-20)15-21(27)25-19-12-8-17(9-13-19)22(24)28/h6-13,20H,1-5,14-15H2,(H2,24,28)(H,25,27)/p+1 |
| InChIKey | ITRTXSHZMRSDSD-UHFFFAOYSA-O |
| XLogP | 2.28 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |