C20H31FN3O2+ — CID 9300165
[2-(tert-butylcarbamoylamino)-2-oxoethyl]-cyclohexyl-[(4-fluorophenyl)methyl]azanium (PubChem CID 9300165) has the molecular formula C20H31FN3O2+ and a molecular weight of 364.49 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl]-cyclohexyl-[(4-fluorophenyl)methyl]azanium.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl]-cyclohexyl-[(4-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 9300165 |
| Molecular Formula | C20H31FN3O2+ |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl]-cyclohexyl-[(4-fluorophenyl)methyl]azanium |
| SMILES | CC(C)(C)NC(=O)NC(=O)C[NH+](Cc1ccc(F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C20H30FN3O2/c1-20(2,3)23-19(26)22-18(25)14-24(17-7-5-4-6-8-17)13-15-9-11-16(21)12-10-15/h9-12,17H,4-8,13-14H2,1-3H3,(H2,22,23,25,26)/p+1 |
| InChIKey | HQSDNRUNFLISDS-UHFFFAOYSA-O |
| XLogP | 2.17 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |