C15H23FN2O — CID 110607188
1-[4-(2-fluorophenyl)butyl]-3-(2-methylpropyl)urea (PubChem CID 110607188) has the molecular formula C15H23FN2O and a molecular weight of 266.36 g/mol. Its IUPAC name is 1-[4-(2-fluorophenyl)butyl]-3-(2-methylpropyl)urea.
| Compound Name | 1-[4-(2-fluorophenyl)butyl]-3-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 110607188 |
| Molecular Formula | C15H23FN2O |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 1-[4-(2-fluorophenyl)butyl]-3-(2-methylpropyl)urea |
| SMILES | CC(C)CNC(=O)NCCCCc1ccccc1F |
| InChI | InChI=1S/C15H23FN2O/c1-12(2)11-18-15(19)17-10-6-5-8-13-7-3-4-9-14(13)16/h3-4,7,9,12H,5-6,8,10-11H2,1-2H3,(H2,17,18,19) |
| InChIKey | QOIOCQICHDSMCW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|