C19H21ClFN2O+ — CID 8977548
[2-(2-chloro-4-methylanilino)-2-oxoethyl]-cyclopropyl-[(2-fluorophenyl)methyl]azanium (PubChem CID 8977548) has the molecular formula C19H21ClFN2O+ and a molecular weight of 347.84 g/mol. Its IUPAC name is [2-(2-chloro-4-methylanilino)-2-oxoethyl]-cyclopropyl-[(2-fluorophenyl)methyl]azanium.
| Compound Name | [2-(2-chloro-4-methylanilino)-2-oxoethyl]-cyclopropyl-[(2-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 8977548 |
| Molecular Formula | C19H21ClFN2O+ |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [2-(2-chloro-4-methylanilino)-2-oxoethyl]-cyclopropyl-[(2-fluorophenyl)methyl]azanium |
| SMILES | Cc1ccc(NC(=O)C[NH+](Cc2ccccc2F)C2CC2)c(Cl)c1 |
| InChI | InChI=1S/C19H20ClFN2O/c1-13-6-9-18(16(20)10-13)22-19(24)12-23(15-7-8-15)11-14-4-2-3-5-17(14)21/h2-6,9-10,15H,7-8,11-12H2,1H3,(H,22,24)/p+1 |
| InChIKey | NQQOIJOEDSJWJB-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |