C20H25ClN3O2+ — CID 9304035
[2-(2-chloro-4-methylanilino)-2-oxoethyl]-[2-(2-ethylanilino)-2-oxoethyl]-methylazanium (PubChem CID 9304035) has the molecular formula C20H25ClN3O2+ and a molecular weight of 374.89 g/mol. Its IUPAC name is [2-(2-chloro-4-methylanilino)-2-oxoethyl]-[2-(2-ethylanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(2-chloro-4-methylanilino)-2-oxoethyl]-[2-(2-ethylanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9304035 |
| Molecular Formula | C20H25ClN3O2+ |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [2-(2-chloro-4-methylanilino)-2-oxoethyl]-[2-(2-ethylanilino)-2-oxoethyl]-methylazanium |
| SMILES | CCc1ccccc1NC(=O)C[NH+](C)CC(=O)Nc1ccc(C)cc1Cl |
| InChI | InChI=1S/C20H24ClN3O2/c1-4-15-7-5-6-8-17(15)22-19(25)12-24(3)13-20(26)23-18-10-9-14(2)11-16(18)21/h5-11H,4,12-13H2,1-3H3,(H,22,25)(H,23,26)/p+1 |
| InChIKey | PKXJOFRJIGMGDA-UHFFFAOYSA-O |
| XLogP | 2.30 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |