C18H23FN3O+ — CID 8978211
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]-cyclopropyl-[(2-fluorophenyl)methyl]azanium (PubChem CID 8978211) has the molecular formula C18H23FN3O+ and a molecular weight of 316.40 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]-cyclopropyl-[(2-fluorophenyl)methyl]azanium.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]-cyclopropyl-[(2-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 8978211 |
| Molecular Formula | C18H23FN3O+ |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]-cyclopropyl-[(2-fluorophenyl)methyl]azanium |
| SMILES | N#CC1(NC(=O)C[NH+](Cc2ccccc2F)C2CC2)CCCC1 |
| InChI | InChI=1S/C18H22FN3O/c19-16-6-2-1-5-14(16)11-22(15-7-8-15)12-17(23)21-18(13-20)9-3-4-10-18/h1-2,5-6,15H,3-4,7-12H2,(H,21,23)/p+1 |
| InChIKey | ODLDNYKMMXPRPZ-UHFFFAOYSA-O |
| XLogP | 1.33 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |