C22H21ClN3O3+ — CID 9393379
[2-(5-chloro-2-nitroanilino)-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium (PubChem CID 9393379) has the molecular formula C22H21ClN3O3+ and a molecular weight of 410.88 g/mol. Its IUPAC name is [2-(5-chloro-2-nitroanilino)-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium.
| Compound Name | [2-(5-chloro-2-nitroanilino)-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium |
|---|---|
| PubChem CID | 9393379 |
| Molecular Formula | C22H21ClN3O3+ |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | [2-(5-chloro-2-nitroanilino)-2-oxoethyl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium |
| SMILES | Cc1ccc([C@@H]([NH2+]CC(=O)Nc2cc(Cl)ccc2[N+](=O)[O-])c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20ClN3O3/c1-15-7-9-17(10-8-15)22(16-5-3-2-4-6-16)24-14-21(27)25-19-13-18(23)11-12-20(19)26(28)29/h2-13,22,24H,14H2,1H3,(H,25,27)/p+1/t22-/m0/s1 |
| InChIKey | FIRPCWDKWLNJEX-QFIPXVFZSA-O |
| XLogP | 3.85 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|