C16H15Cl2N3O3 — CID 9336439
N-(5-chloro-2-nitrophenyl)-2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]acetamide (PubChem CID 9336439) has the molecular formula C16H15Cl2N3O3 and a molecular weight of 368.22 g/mol. Its IUPAC name is N-(5-chloro-2-nitrophenyl)-2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]acetamide.
| Compound Name | N-(5-chloro-2-nitrophenyl)-2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 9336439 |
| Molecular Formula | C16H15Cl2N3O3 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | N-(5-chloro-2-nitrophenyl)-2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]acetamide |
| SMILES | C[C@H](NCC(=O)Nc1cc(Cl)ccc1[N+](=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2N3O3/c1-10(11-2-4-12(17)5-3-11)19-9-16(22)20-14-8-13(18)6-7-15(14)21(23)24/h2-8,10,19H,9H2,1H3,(H,20,22)/t10-/m0/s1 |
| InChIKey | QLTINLXAPOWVTB-JTQLQIEISA-N |
| XLogP | 4.19 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|