C21H22N3O3S+ — CID 8769107
[(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]-[2-(4-nitroanilino)-2-oxoethyl]azanium (PubChem CID 8769107) has the molecular formula C21H22N3O3S+ and a molecular weight of 396.49 g/mol. Its IUPAC name is [(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]-[2-(4-nitroanilino)-2-oxoethyl]azanium.
| Compound Name | [(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]-[2-(4-nitroanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8769107 |
| Molecular Formula | C21H22N3O3S+ |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]-[2-(4-nitroanilino)-2-oxoethyl]azanium |
| SMILES | CCc1ccc([C@H]([NH2+]CC(=O)Nc2ccc([N+](=O)[O-])cc2)c2cccs2)cc1 |
| InChI | InChI=1S/C21H21N3O3S/c1-2-15-5-7-16(8-6-15)21(19-4-3-13-28-19)22-14-20(25)23-17-9-11-18(12-10-17)24(26)27/h3-13,21-22H,2,14H2,1H3,(H,23,25)/p+1/t21-/m0/s1 |
| InChIKey | GIVWKKMRTUAULK-NRFANRHFSA-O |
| XLogP | 3.51 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|