C21H22ClN2OS+ — CID 8768993
[2-(2-chloroanilino)-2-oxoethyl]-[(R)-(4-ethylphenyl)-thiophen-2-ylmethyl]azanium (PubChem CID 8768993) has the molecular formula C21H22ClN2OS+ and a molecular weight of 385.94 g/mol. Its IUPAC name is [2-(2-chloroanilino)-2-oxoethyl]-[(R)-(4-ethylphenyl)-thiophen-2-ylmethyl]azanium.
| Compound Name | [2-(2-chloroanilino)-2-oxoethyl]-[(R)-(4-ethylphenyl)-thiophen-2-ylmethyl]azanium |
|---|---|
| PubChem CID | 8768993 |
| Molecular Formula | C21H22ClN2OS+ |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | [2-(2-chloroanilino)-2-oxoethyl]-[(R)-(4-ethylphenyl)-thiophen-2-ylmethyl]azanium |
| SMILES | CCc1ccc([C@@H]([NH2+]CC(=O)Nc2ccccc2Cl)c2cccs2)cc1 |
| InChI | InChI=1S/C21H21ClN2OS/c1-2-15-9-11-16(12-10-15)21(19-8-5-13-26-19)23-14-20(25)24-18-7-4-3-6-17(18)22/h3-13,21,23H,2,14H2,1H3,(H,24,25)/p+1/t21-/m1/s1 |
| InChIKey | HLUWOWLNWNDOAF-OAQYLSRUSA-O |
| XLogP | 4.26 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |