C18H17ClN3OS+ — CID 9050750
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium (PubChem CID 9050750) has the molecular formula C18H17ClN3OS+ and a molecular weight of 358.87 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 9050750 |
| Molecular Formula | C18H17ClN3OS+ |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium |
| SMILES | O=C(C[NH2+][C@H](c1ccccc1)c1cccs1)Nc1cccnc1Cl |
| InChI | InChI=1S/C18H16ClN3OS/c19-18-14(8-4-10-20-18)22-16(23)12-21-17(15-9-5-11-24-15)13-6-2-1-3-7-13/h1-11,17,21H,12H2,(H,22,23)/p+1/t17-/m1/s1 |
| InChIKey | WZHQNHOQGJQBAV-QGZVFWFLSA-O |
| XLogP | 3.09 |
| TPSA | 58.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|