C15H16Cl2N3O+ — CID 9397823
[(1S)-1-(4-chlorophenyl)ethyl]-[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]azanium (PubChem CID 9397823) has the molecular formula C15H16Cl2N3O+ and a molecular weight of 325.22 g/mol. Its IUPAC name is [(1S)-1-(4-chlorophenyl)ethyl]-[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(4-chlorophenyl)ethyl]-[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9397823 |
| Molecular Formula | C15H16Cl2N3O+ |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | [(1S)-1-(4-chlorophenyl)ethyl]-[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)Nc1cccnc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H15Cl2N3O/c1-10(11-4-6-12(16)7-5-11)19-9-14(21)20-13-3-2-8-18-15(13)17/h2-8,10,19H,9H2,1H3,(H,20,21)/p+1/t10-/m0/s1 |
| InChIKey | UHXXYSXGQRBRKN-JTQLQIEISA-O |
| XLogP | 2.65 |
| TPSA | 58.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|