C24H20ClN2O3+ — CID 9336183
[(1S)-1-(4-chlorophenyl)ethyl]-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]azanium (PubChem CID 9336183) has the molecular formula C24H20ClN2O3+ and a molecular weight of 419.89 g/mol. Its IUPAC name is [(1S)-1-(4-chlorophenyl)ethyl]-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(4-chlorophenyl)ethyl]-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9336183 |
| Molecular Formula | C24H20ClN2O3+ |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [(1S)-1-(4-chlorophenyl)ethyl]-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19ClN2O3/c1-14(15-9-11-16(25)12-10-15)26-13-21(28)27-20-8-4-7-19-22(20)24(30)18-6-3-2-5-17(18)23(19)29/h2-12,14,26H,13H2,1H3,(H,27,28)/p+1/t14-/m0/s1 |
| InChIKey | ZHRCDXYNQRISBE-AWEZNQCLSA-O |
| XLogP | 3.38 |
| TPSA | 79.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|