C16H17ClIN2O+ — CID 9336464
[(1S)-1-(4-chlorophenyl)ethyl]-[2-(3-iodoanilino)-2-oxoethyl]azanium (PubChem CID 9336464) has the molecular formula C16H17ClIN2O+ and a molecular weight of 415.68 g/mol. Its IUPAC name is [(1S)-1-(4-chlorophenyl)ethyl]-[2-(3-iodoanilino)-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(4-chlorophenyl)ethyl]-[2-(3-iodoanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9336464 |
| Molecular Formula | C16H17ClIN2O+ |
| Molecular Weight | 415.68 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | [(1S)-1-(4-chlorophenyl)ethyl]-[2-(3-iodoanilino)-2-oxoethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)Nc1cccc(I)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H16ClIN2O/c1-11(12-5-7-13(17)8-6-12)19-10-16(21)20-15-4-2-3-14(18)9-15/h2-9,11,19H,10H2,1H3,(H,20,21)/p+1/t11-/m0/s1 |
| InChIKey | DUKLSLKZJGJSAE-NSHDSACASA-O |
| XLogP | 3.21 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.68 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|