C17H19Cl2N2O+ — CID 9336391
[2-(4-chloro-2-methylanilino)-2-oxoethyl]-[(1S)-1-(4-chlorophenyl)ethyl]azanium (PubChem CID 9336391) has the molecular formula C17H19Cl2N2O+ and a molecular weight of 338.26 g/mol. Its IUPAC name is [2-(4-chloro-2-methylanilino)-2-oxoethyl]-[(1S)-1-(4-chlorophenyl)ethyl]azanium.
| Compound Name | [2-(4-chloro-2-methylanilino)-2-oxoethyl]-[(1S)-1-(4-chlorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9336391 |
| Molecular Formula | C17H19Cl2N2O+ |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | [2-(4-chloro-2-methylanilino)-2-oxoethyl]-[(1S)-1-(4-chlorophenyl)ethyl]azanium |
| SMILES | Cc1cc(Cl)ccc1NC(=O)C[NH2+][C@@H](C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18Cl2N2O/c1-11-9-15(19)7-8-16(11)21-17(22)10-20-12(2)13-3-5-14(18)6-4-13/h3-9,12,20H,10H2,1-2H3,(H,21,22)/p+1/t12-/m0/s1 |
| InChIKey | MKGTUFPOKRHXGJ-LBPRGKRZSA-O |
| XLogP | 3.56 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |