C17H20ClN2O2+ — CID 9307738
[(1R)-1-(3-chlorophenyl)ethyl]-[2-(3-methoxyanilino)-2-oxoethyl]azanium (PubChem CID 9307738) has the molecular formula C17H20ClN2O2+ and a molecular weight of 319.81 g/mol. Its IUPAC name is [(1R)-1-(3-chlorophenyl)ethyl]-[2-(3-methoxyanilino)-2-oxoethyl]azanium.
| Compound Name | [(1R)-1-(3-chlorophenyl)ethyl]-[2-(3-methoxyanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9307738 |
| Molecular Formula | C17H20ClN2O2+ |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | [(1R)-1-(3-chlorophenyl)ethyl]-[2-(3-methoxyanilino)-2-oxoethyl]azanium |
| SMILES | COc1cccc(NC(=O)C[NH2+][C@H](C)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C17H19ClN2O2/c1-12(13-5-3-6-14(18)9-13)19-11-17(21)20-15-7-4-8-16(10-15)22-2/h3-10,12,19H,11H2,1-2H3,(H,20,21)/p+1/t12-/m1/s1 |
| InChIKey | OOHDEEVTQGMSNW-GFCCVEGCSA-O |
| XLogP | 2.61 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |