C17H19Cl2N2O2+ — CID 9253921
[(1S)-1-(2,4-dichlorophenyl)ethyl]-[2-(3-methoxyanilino)-2-oxoethyl]azanium (PubChem CID 9253921) has the molecular formula C17H19Cl2N2O2+ and a molecular weight of 354.26 g/mol. Its IUPAC name is [(1S)-1-(2,4-dichlorophenyl)ethyl]-[2-(3-methoxyanilino)-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(2,4-dichlorophenyl)ethyl]-[2-(3-methoxyanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9253921 |
| Molecular Formula | C17H19Cl2N2O2+ |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | [(1S)-1-(2,4-dichlorophenyl)ethyl]-[2-(3-methoxyanilino)-2-oxoethyl]azanium |
| SMILES | COc1cccc(NC(=O)C[NH2+][C@@H](C)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H18Cl2N2O2/c1-11(15-7-6-12(18)8-16(15)19)20-10-17(22)21-13-4-3-5-14(9-13)23-2/h3-9,11,20H,10H2,1-2H3,(H,21,22)/p+1/t11-/m0/s1 |
| InChIKey | KWXNLJGMWAAWPU-NSHDSACASA-O |
| XLogP | 3.27 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |