C21H23ClN3OS+ — CID 9136200
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(R)-(4-propylphenyl)-thiophen-2-ylmethyl]azanium (PubChem CID 9136200) has the molecular formula C21H23ClN3OS+ and a molecular weight of 400.96 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(R)-(4-propylphenyl)-thiophen-2-ylmethyl]azanium.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(R)-(4-propylphenyl)-thiophen-2-ylmethyl]azanium |
|---|---|
| PubChem CID | 9136200 |
| Molecular Formula | C21H23ClN3OS+ |
| Molecular Weight | 400.96 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(R)-(4-propylphenyl)-thiophen-2-ylmethyl]azanium |
| SMILES | CCCc1ccc([C@@H]([NH2+]CC(=O)Nc2cccnc2Cl)c2cccs2)cc1 |
| InChI | InChI=1S/C21H22ClN3OS/c1-2-5-15-8-10-16(11-9-15)20(18-7-4-13-27-18)24-14-19(26)25-17-6-3-12-23-21(17)22/h3-4,6-13,20,24H,2,5,14H2,1H3,(H,25,26)/p+1/t20-/m1/s1 |
| InChIKey | GBHNDDMSIKAWGE-HXUWFJFHSA-O |
| XLogP | 4.04 |
| TPSA | 58.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.96 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|