C16H23FN3O2+ — CID 2448759
[2-(3-fluoroanilino)-2-oxoethyl]-methyl-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]azanium (PubChem CID 2448759) has the molecular formula C16H23FN3O2+ and a molecular weight of 308.38 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl]-methyl-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]azanium.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl]-methyl-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 2448759 |
| Molecular Formula | C16H23FN3O2+ |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl]-methyl-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]azanium |
| SMILES | C[C@@H](C(=O)N1CCCC1)[NH+](C)CC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C16H22FN3O2/c1-12(16(22)20-8-3-4-9-20)19(2)11-15(21)18-14-7-5-6-13(17)10-14/h5-7,10,12H,3-4,8-9,11H2,1-2H3,(H,18,21)/p+1/t12-/m0/s1 |
| InChIKey | VVDIQHPUSSWTEA-LBPRGKRZSA-O |
| XLogP | 0.29 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |