C25H28N3OS+ — CID 135756690
(E)-N-(3,5-dimethylphenyl)-3-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135756690) has the molecular formula C25H28N3OS+ and a molecular weight of 418.59 g/mol. Its IUPAC name is (E)-N-(3,5-dimethylphenyl)-3-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | (E)-N-(3,5-dimethylphenyl)-3-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135756690 |
| Molecular Formula | C25H28N3OS+ |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (E)-N-(3,5-dimethylphenyl)-3-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | C=CCn1c(C)cc(/C(O)=C(/C(=S)Nc2cc(C)cc(C)c2)[n+]2ccccc2)c1C |
| InChI | InChI=1S/C25H27N3OS/c1-6-10-28-19(4)16-22(20(28)5)24(29)23(27-11-8-7-9-12-27)25(30)26-21-14-17(2)13-18(3)15-21/h6-9,11-16H,1,10H2,2-5H3,(H-,26,29,30)/p+1 |
| InChIKey | IHXINFICTCPRQS-UHFFFAOYSA-O |
| XLogP | 5.52 |
| TPSA | 41.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|