C26H28FN2OS+ — CID 135481522
2-(4-tert-butylpyridin-1-ium-1-yl)-N-(3,5-dimethylphenyl)-3-(4-fluorophenyl)-3-hydroxyprop-2-enethioamide (PubChem CID 135481522) has the molecular formula C26H28FN2OS+ and a molecular weight of 435.59 g/mol. Its IUPAC name is 2-(4-tert-butylpyridin-1-ium-1-yl)-N-(3,5-dimethylphenyl)-3-(4-fluorophenyl)-3-hydroxyprop-2-enethioamide.
| Compound Name | 2-(4-tert-butylpyridin-1-ium-1-yl)-N-(3,5-dimethylphenyl)-3-(4-fluorophenyl)-3-hydroxyprop-2-enethioamide |
|---|---|
| PubChem CID | 135481522 |
| Molecular Formula | C26H28FN2OS+ |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 2-(4-tert-butylpyridin-1-ium-1-yl)-N-(3,5-dimethylphenyl)-3-(4-fluorophenyl)-3-hydroxyprop-2-enethioamide |
| SMILES | Cc1cc(C)cc(NC(=S)C(=C(O)c2ccc(F)cc2)[n+]2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C26H27FN2OS/c1-17-14-18(2)16-22(15-17)28-25(31)23(24(30)19-6-8-21(27)9-7-19)29-12-10-20(11-13-29)26(3,4)5/h6-16H,1-5H3,(H-,28,30,31)/p+1 |
| InChIKey | DFJWTBAUVIZYTQ-UHFFFAOYSA-O |
| XLogP | 6.35 |
| TPSA | 36.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|