C24H26N2OS2 — CID 3877190
2-(4-tert-butylpyridin-1-ium-1-yl)-3-(3,5-dimethylanilino)-3-sulfanylidene-1-thiophen-2-ylprop-1-en-1-olate (PubChem CID 3877190) has the molecular formula C24H26N2OS2 and a molecular weight of 422.62 g/mol. Its IUPAC name is 2-(4-tert-butylpyridin-1-ium-1-yl)-3-(3,5-dimethylanilino)-3-sulfanylidene-1-thiophen-2-ylprop-1-en-1-olate.
| Compound Name | 2-(4-tert-butylpyridin-1-ium-1-yl)-3-(3,5-dimethylanilino)-3-sulfanylidene-1-thiophen-2-ylprop-1-en-1-olate |
|---|---|
| PubChem CID | 3877190 |
| Molecular Formula | C24H26N2OS2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-(4-tert-butylpyridin-1-ium-1-yl)-3-(3,5-dimethylanilino)-3-sulfanylidene-1-thiophen-2-ylprop-1-en-1-olate |
| SMILES | Cc1cc(C)cc(NC(=S)C(=C([O-])c2cccs2)[n+]2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C24H26N2OS2/c1-16-13-17(2)15-19(14-16)25-23(28)21(22(27)20-7-6-12-29-20)26-10-8-18(9-11-26)24(3,4)5/h6-15H,1-5H3,(H-,25,27,28) |
| InChIKey | NZVSTHZDTBLYLS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 38.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|