C20H18N2OS2 — CID 8861545
3-(3-ethylanilino)-2-pyridin-1-ium-1-yl-3-sulfanylidene-1-thiophen-2-ylprop-1-en-1-olate (PubChem CID 8861545) has the molecular formula C20H18N2OS2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 3-(3-ethylanilino)-2-pyridin-1-ium-1-yl-3-sulfanylidene-1-thiophen-2-ylprop-1-en-1-olate.
| Compound Name | 3-(3-ethylanilino)-2-pyridin-1-ium-1-yl-3-sulfanylidene-1-thiophen-2-ylprop-1-en-1-olate |
|---|---|
| PubChem CID | 8861545 |
| Molecular Formula | C20H18N2OS2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 3-(3-ethylanilino)-2-pyridin-1-ium-1-yl-3-sulfanylidene-1-thiophen-2-ylprop-1-en-1-olate |
| SMILES | CCc1cccc(NC(=S)C(=C([O-])c2cccs2)[n+]2ccccc2)c1 |
| InChI | InChI=1S/C20H18N2OS2/c1-2-15-8-6-9-16(14-15)21-20(24)18(22-11-4-3-5-12-22)19(23)17-10-7-13-25-17/h3-14H,2H2,1H3,(H-,21,23,24) |
| InChIKey | USPTYWFRSRSKLT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 38.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|