C20H17ClN2OS2 — CID 8861563
1-(5-chlorothiophen-2-yl)-3-(3-ethylanilino)-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate (PubChem CID 8861563) has the molecular formula C20H17ClN2OS2 and a molecular weight of 400.96 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-3-(3-ethylanilino)-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate.
| Compound Name | 1-(5-chlorothiophen-2-yl)-3-(3-ethylanilino)-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate |
|---|---|
| PubChem CID | 8861563 |
| Molecular Formula | C20H17ClN2OS2 |
| Molecular Weight | 400.96 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-3-(3-ethylanilino)-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate |
| SMILES | CCc1cccc(NC(=S)C(=C([O-])c2ccc(Cl)s2)[n+]2ccccc2)c1 |
| InChI | InChI=1S/C20H17ClN2OS2/c1-2-14-7-6-8-15(13-14)22-20(25)18(23-11-4-3-5-12-23)19(24)16-9-10-17(21)26-16/h3-13H,2H2,1H3,(H-,22,24,25) |
| InChIKey | MQIAOJXGFTVLFR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.96 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|