C20H18ClN2O2S2+ — CID 135761274
3-(5-chlorothiophen-2-yl)-N-(2-ethoxyphenyl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135761274) has the molecular formula C20H18ClN2O2S2+ and a molecular weight of 417.96 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-N-(2-ethoxyphenyl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | 3-(5-chlorothiophen-2-yl)-N-(2-ethoxyphenyl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135761274 |
| Molecular Formula | C20H18ClN2O2S2+ |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-N-(2-ethoxyphenyl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | CCOc1ccccc1NC(=S)C(=C(O)c1ccc(Cl)s1)[n+]1ccccc1 |
| InChI | InChI=1S/C20H17ClN2O2S2/c1-2-25-15-9-5-4-8-14(15)22-20(26)18(23-12-6-3-7-13-23)19(24)16-10-11-17(21)27-16/h3-13H,2H2,1H3,(H-,22,24,26)/p+1 |
| InChIKey | SNZFIXRXMQEBMR-UHFFFAOYSA-O |
| XLogP | 5.41 |
| TPSA | 45.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|