C20H19N2OS2+ — CID 135401235
(E)-N-(2,6-dimethylphenyl)-3-hydroxy-2-pyridin-1-ium-1-yl-3-thiophen-2-ylprop-2-enethioamide (PubChem CID 135401235) has the molecular formula C20H19N2OS2+ and a molecular weight of 367.52 g/mol. Its IUPAC name is (E)-N-(2,6-dimethylphenyl)-3-hydroxy-2-pyridin-1-ium-1-yl-3-thiophen-2-ylprop-2-enethioamide.
| Compound Name | (E)-N-(2,6-dimethylphenyl)-3-hydroxy-2-pyridin-1-ium-1-yl-3-thiophen-2-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135401235 |
| Molecular Formula | C20H19N2OS2+ |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | (E)-N-(2,6-dimethylphenyl)-3-hydroxy-2-pyridin-1-ium-1-yl-3-thiophen-2-ylprop-2-enethioamide |
| SMILES | Cc1cccc(C)c1NC(=S)/C(=C(\O)c1cccs1)[n+]1ccccc1 |
| InChI | InChI=1S/C20H18N2OS2/c1-14-8-6-9-15(2)17(14)21-20(24)18(22-11-4-3-5-12-22)19(23)16-10-7-13-25-16/h3-13H,1-2H3,(H-,21,23,24)/p+1 |
| InChIKey | YVCNVCAVELTAQD-UHFFFAOYSA-O |
| XLogP | 4.98 |
| TPSA | 36.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|