C24H25N2OS+ — CID 135924665
(E)-N-(2,6-dimethylphenyl)-3-(4-ethylphenyl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135924665) has the molecular formula C24H25N2OS+ and a molecular weight of 389.54 g/mol. Its IUPAC name is (E)-N-(2,6-dimethylphenyl)-3-(4-ethylphenyl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | (E)-N-(2,6-dimethylphenyl)-3-(4-ethylphenyl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135924665 |
| Molecular Formula | C24H25N2OS+ |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (E)-N-(2,6-dimethylphenyl)-3-(4-ethylphenyl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | CCc1ccc(/C(O)=C(/C(=S)Nc2c(C)cccc2C)[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N2OS/c1-4-19-11-13-20(14-12-19)23(27)22(26-15-6-5-7-16-26)24(28)25-21-17(2)9-8-10-18(21)3/h5-16H,4H2,1-3H3,(H-,25,27,28)/p+1 |
| InChIKey | KKBPSTYMRBEHRH-UHFFFAOYSA-O |
| XLogP | 5.48 |
| TPSA | 36.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|