C25H26N2O2S — CID 8714824
3-(2,6-dimethylanilino)-1-(4-ethylphenyl)-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-sulfanylideneprop-1-en-1-olate (PubChem CID 8714824) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is 3-(2,6-dimethylanilino)-1-(4-ethylphenyl)-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-sulfanylideneprop-1-en-1-olate.
| Compound Name | 3-(2,6-dimethylanilino)-1-(4-ethylphenyl)-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-sulfanylideneprop-1-en-1-olate |
|---|---|
| PubChem CID | 8714824 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 3-(2,6-dimethylanilino)-1-(4-ethylphenyl)-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-sulfanylideneprop-1-en-1-olate |
| SMILES | CCc1ccc(C([O-])=C(C(=S)Nc2c(C)cccc2C)[n+]2cccc(CO)c2)cc1 |
| InChI | InChI=1S/C25H26N2O2S/c1-4-19-10-12-21(13-11-19)24(29)23(27-14-6-9-20(15-27)16-28)25(30)26-22-17(2)7-5-8-18(22)3/h5-15,28H,4,16H2,1-3H3,(H-,26,29,30) |
| InChIKey | UHYXLCBYRVMIMU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|