C22H20N3O3S+ — CID 135797076
N-(2,3-dimethylphenyl)-3-hydroxy-3-(4-nitrophenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135797076) has the molecular formula C22H20N3O3S+ and a molecular weight of 406.49 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-3-hydroxy-3-(4-nitrophenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | N-(2,3-dimethylphenyl)-3-hydroxy-3-(4-nitrophenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135797076 |
| Molecular Formula | C22H20N3O3S+ |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-(2,3-dimethylphenyl)-3-hydroxy-3-(4-nitrophenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | Cc1cccc(NC(=S)C(=C(O)c2ccc([N+](=O)[O-])cc2)[n+]2ccccc2)c1C |
| InChI | InChI=1S/C22H19N3O3S/c1-15-7-6-8-19(16(15)2)23-22(29)20(24-13-4-3-5-14-24)21(26)17-9-11-18(12-10-17)25(27)28/h3-14H,1-2H3,(H-,23,26,29)/p+1 |
| InChIKey | JKXUSVUSVVUPIW-UHFFFAOYSA-O |
| XLogP | 4.82 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|