C21H17ClN3O3S+ — CID 135982941
(E)-N-(3-chloro-2-methylphenyl)-3-hydroxy-3-(4-nitrophenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135982941) has the molecular formula C21H17ClN3O3S+ and a molecular weight of 426.91 g/mol. Its IUPAC name is (E)-N-(3-chloro-2-methylphenyl)-3-hydroxy-3-(4-nitrophenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | (E)-N-(3-chloro-2-methylphenyl)-3-hydroxy-3-(4-nitrophenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135982941 |
| Molecular Formula | C21H17ClN3O3S+ |
| Molecular Weight | 426.91 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | (E)-N-(3-chloro-2-methylphenyl)-3-hydroxy-3-(4-nitrophenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | Cc1c(Cl)cccc1NC(=S)/C(=C(\O)c1ccc([N+](=O)[O-])cc1)[n+]1ccccc1 |
| InChI | InChI=1S/C21H16ClN3O3S/c1-14-17(22)6-5-7-18(14)23-21(29)19(24-12-3-2-4-13-24)20(26)15-8-10-16(11-9-15)25(27)28/h2-13H,1H3,(H-,23,26,29)/p+1 |
| InChIKey | RSCQJGNQLLXXSR-UHFFFAOYSA-O |
| XLogP | 5.17 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.91 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|