C23H22F3N2OS2+ — CID 135443808
2-(4-tert-butylpyridin-1-ium-1-yl)-3-hydroxy-3-thiophen-2-yl-N-[3-(trifluoromethyl)phenyl]prop-2-enethioamide (PubChem CID 135443808) has the molecular formula C23H22F3N2OS2+ and a molecular weight of 463.57 g/mol. Its IUPAC name is 2-(4-tert-butylpyridin-1-ium-1-yl)-3-hydroxy-3-thiophen-2-yl-N-[3-(trifluoromethyl)phenyl]prop-2-enethioamide.
| Compound Name | 2-(4-tert-butylpyridin-1-ium-1-yl)-3-hydroxy-3-thiophen-2-yl-N-[3-(trifluoromethyl)phenyl]prop-2-enethioamide |
|---|---|
| PubChem CID | 135443808 |
| Molecular Formula | C23H22F3N2OS2+ |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 2-(4-tert-butylpyridin-1-ium-1-yl)-3-hydroxy-3-thiophen-2-yl-N-[3-(trifluoromethyl)phenyl]prop-2-enethioamide |
| SMILES | CC(C)(C)c1cc[n+](C(C(=S)Nc2cccc(C(F)(F)F)c2)=C(O)c2cccs2)cc1 |
| InChI | InChI=1S/C23H21F3N2OS2/c1-22(2,3)15-9-11-28(12-10-15)19(20(29)18-8-5-13-31-18)21(30)27-17-7-4-6-16(14-17)23(24,25)26/h4-14H,1-3H3,(H-,27,29,30)/p+1 |
| InChIKey | VRAVMOKYENKROR-UHFFFAOYSA-O |
| XLogP | 6.68 |
| TPSA | 36.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|