C24H26N2O2S2 — CID 3963194
2-(4-tert-butylpyridin-1-ium-1-yl)-3-(4-ethoxyanilino)-3-sulfanylidene-1-thiophen-2-ylprop-1-en-1-olate (PubChem CID 3963194) has the molecular formula C24H26N2O2S2 and a molecular weight of 438.62 g/mol. Its IUPAC name is 2-(4-tert-butylpyridin-1-ium-1-yl)-3-(4-ethoxyanilino)-3-sulfanylidene-1-thiophen-2-ylprop-1-en-1-olate.
| Compound Name | 2-(4-tert-butylpyridin-1-ium-1-yl)-3-(4-ethoxyanilino)-3-sulfanylidene-1-thiophen-2-ylprop-1-en-1-olate |
|---|---|
| PubChem CID | 3963194 |
| Molecular Formula | C24H26N2O2S2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 2-(4-tert-butylpyridin-1-ium-1-yl)-3-(4-ethoxyanilino)-3-sulfanylidene-1-thiophen-2-ylprop-1-en-1-olate |
| SMILES | CCOc1ccc(NC(=S)C(=C([O-])c2cccs2)[n+]2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H26N2O2S2/c1-5-28-19-10-8-18(9-11-19)25-23(29)21(22(27)20-7-6-16-30-20)26-14-12-17(13-15-26)24(2,3)4/h6-16H,5H2,1-4H3,(H-,25,27,29) |
| InChIKey | MAADUHFRMKHBEP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 48.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|