C19H20Cl2N2O3 — CID 43954358
ethyl 4-[(2,4-dichlorophenyl)carbamoyl]-3,5-dimethyl-1-prop-2-enylpyrrole-2-carboxylate (PubChem CID 43954358) has the molecular formula C19H20Cl2N2O3 and a molecular weight of 395.29 g/mol. Its IUPAC name is ethyl 4-[(2,4-dichlorophenyl)carbamoyl]-3,5-dimethyl-1-prop-2-enylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-[(2,4-dichlorophenyl)carbamoyl]-3,5-dimethyl-1-prop-2-enylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 43954358 |
| Molecular Formula | C19H20Cl2N2O3 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | ethyl 4-[(2,4-dichlorophenyl)carbamoyl]-3,5-dimethyl-1-prop-2-enylpyrrole-2-carboxylate |
| SMILES | C=CCn1c(C)c(C(=O)Nc2ccc(Cl)cc2Cl)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C19H20Cl2N2O3/c1-5-9-23-12(4)16(11(3)17(23)19(25)26-6-2)18(24)22-15-8-7-13(20)10-14(15)21/h5,7-8,10H,1,6,9H2,2-4H3,(H,22,24) |
| InChIKey | NKAMUWFROGOMRT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|