C25H26N2O4 — CID 43954347
ethyl 3,5-dimethyl-4-[(4-phenoxyphenyl)carbamoyl]-1-prop-2-enylpyrrole-2-carboxylate (PubChem CID 43954347) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is ethyl 3,5-dimethyl-4-[(4-phenoxyphenyl)carbamoyl]-1-prop-2-enylpyrrole-2-carboxylate.
| Compound Name | ethyl 3,5-dimethyl-4-[(4-phenoxyphenyl)carbamoyl]-1-prop-2-enylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 43954347 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | ethyl 3,5-dimethyl-4-[(4-phenoxyphenyl)carbamoyl]-1-prop-2-enylpyrrole-2-carboxylate |
| SMILES | C=CCn1c(C)c(C(=O)Nc2ccc(Oc3ccccc3)cc2)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C25H26N2O4/c1-5-16-27-18(4)22(17(3)23(27)25(29)30-6-2)24(28)26-19-12-14-21(15-13-19)31-20-10-8-7-9-11-20/h5,7-15H,1,6,16H2,2-4H3,(H,26,28) |
| InChIKey | AHBTUFRVBPYHFK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|