C29H30FN4O2S+ — CID 135497552
2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-3-hydroxy-N-(3-methoxyphenyl)prop-2-enethioamide (PubChem CID 135497552) has the molecular formula C29H30FN4O2S+ and a molecular weight of 517.65 g/mol. Its IUPAC name is 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-3-hydroxy-N-(3-methoxyphenyl)prop-2-enethioamide.
| Compound Name | 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-3-hydroxy-N-(3-methoxyphenyl)prop-2-enethioamide |
|---|---|
| PubChem CID | 135497552 |
| Molecular Formula | C29H30FN4O2S+ |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-3-hydroxy-N-(3-methoxyphenyl)prop-2-enethioamide |
| SMILES | COc1cccc(NC(=S)C(=C(O)c2cc(C)n(-c3ccccc3F)c2C)[n+]2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C29H29FN4O2S/c1-19-17-24(20(2)34(19)26-12-7-6-11-25(26)30)28(35)27(33-15-13-22(14-16-33)32(3)4)29(37)31-21-9-8-10-23(18-21)36-5/h6-18H,1-5H3,(H-,31,35,37)/p+1 |
| InChIKey | SPXAEOGJFGONQC-UHFFFAOYSA-O |
| XLogP | 5.92 |
| TPSA | 53.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|