C21H18ClN2O2S+ — CID 135761370
3-(4-chlorophenyl)-3-hydroxy-N-(3-methoxyphenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135761370) has the molecular formula C21H18ClN2O2S+ and a molecular weight of 397.91 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-hydroxy-N-(3-methoxyphenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | 3-(4-chlorophenyl)-3-hydroxy-N-(3-methoxyphenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135761370 |
| Molecular Formula | C21H18ClN2O2S+ |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 3-(4-chlorophenyl)-3-hydroxy-N-(3-methoxyphenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | COc1cccc(NC(=S)C(=C(O)c2ccc(Cl)cc2)[n+]2ccccc2)c1 |
| InChI | InChI=1S/C21H17ClN2O2S/c1-26-18-7-5-6-17(14-18)23-21(27)19(24-12-3-2-4-13-24)20(25)15-8-10-16(22)11-9-15/h2-14H,1H3,(H-,23,25,27)/p+1 |
| InChIKey | HEJUTAWTRDJSAV-UHFFFAOYSA-O |
| XLogP | 4.96 |
| TPSA | 45.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|