C21H15BrF2N2OS2 — CID 42992908
(E)-1-(2-bromophenyl)-3-[4-(difluoromethylsulfanyl)anilino]-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate (PubChem CID 42992908) has the molecular formula C21H15BrF2N2OS2 and a molecular weight of 493.40 g/mol. Its IUPAC name is (E)-1-(2-bromophenyl)-3-[4-(difluoromethylsulfanyl)anilino]-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate.
| Compound Name | (E)-1-(2-bromophenyl)-3-[4-(difluoromethylsulfanyl)anilino]-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate |
|---|---|
| PubChem CID | 42992908 |
| Molecular Formula | C21H15BrF2N2OS2 |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | (E)-1-(2-bromophenyl)-3-[4-(difluoromethylsulfanyl)anilino]-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate |
| SMILES | [O-]/C(=C(\C(=S)Nc1ccc(SC(F)F)cc1)[n+]1ccccc1)c1ccccc1Br |
| InChI | InChI=1S/C21H15BrF2N2OS2/c22-17-7-3-2-6-16(17)19(27)18(26-12-4-1-5-13-26)20(28)25-14-8-10-15(11-9-14)29-21(23)24/h1-13,21H,(H-,25,27,28) |
| InChIKey | WIEKHPQZCFSCBI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 38.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|