C25H24N4O6S2 — CID 3946390
2-(3-methylpyridin-1-ium-1-yl)-3-(4-morpholin-4-ylsulfonylanilino)-1-(4-nitrophenyl)-3-sulfanylideneprop-1-en-1-olate (PubChem CID 3946390) has the molecular formula C25H24N4O6S2 and a molecular weight of 540.62 g/mol. Its IUPAC name is 2-(3-methylpyridin-1-ium-1-yl)-3-(4-morpholin-4-ylsulfonylanilino)-1-(4-nitrophenyl)-3-sulfanylideneprop-1-en-1-olate.
| Compound Name | 2-(3-methylpyridin-1-ium-1-yl)-3-(4-morpholin-4-ylsulfonylanilino)-1-(4-nitrophenyl)-3-sulfanylideneprop-1-en-1-olate |
|---|---|
| PubChem CID | 3946390 |
| Molecular Formula | C25H24N4O6S2 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | 2-(3-methylpyridin-1-ium-1-yl)-3-(4-morpholin-4-ylsulfonylanilino)-1-(4-nitrophenyl)-3-sulfanylideneprop-1-en-1-olate |
| SMILES | Cc1ccc[n+](C(C(=S)Nc2ccc(S(=O)(=O)N3CCOCC3)cc2)=C([O-])c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C25H24N4O6S2/c1-18-3-2-12-27(17-18)23(24(30)19-4-8-21(9-5-19)29(31)32)25(36)26-20-6-10-22(11-7-20)37(33,34)28-13-15-35-16-14-28/h2-12,17H,13-16H2,1H3,(H-,26,30,36) |
| InChIKey | UYOGKALLBOSNOX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|